C25H26BrNO4S2 — CID 19196193
ethyl 6-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19196193) has the molecular formula C25H26BrNO4S2 and a molecular weight of 548.52 g/mol. Its IUPAC name is ethyl 6-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | ethyl 6-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19196193 |
| Molecular Formula | C25H26BrNO4S2 |
| Molecular Weight | 548.52 g/mol |
| Exact Mass | 547.05 |
| IUPAC Name | ethyl 6-[(5E)-5-[[4-[(3-bromophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)/C(=C\c2ccc(OCc3cccc(Br)c3)cc2)SC1=S |
| InChI | InChI=1S/C25H26BrNO4S2/c1-2-30-23(28)9-4-3-5-14-27-24(29)22(33-25(27)32)16-18-10-12-21(13-11-18)31-17-19-7-6-8-20(26)15-19/h6-8,10-13,15-16H,2-5,9,14,17H2,1H3/b22-16+ |
| InChIKey | LLSUDVKRARYKGE-CJLVFECKSA-N |
| XLogP | 6.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.52 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|