C30H29BrN2O4S2 — CID 19200809
4-bromo-N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19200809) has the molecular formula C30H29BrN2O4S2 and a molecular weight of 625.61 g/mol. Its IUPAC name is 4-bromo-N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-bromo-N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19200809 |
| Molecular Formula | C30H29BrN2O4S2 |
| Molecular Weight | 625.61 g/mol |
| Exact Mass | 624.08 |
| IUPAC Name | 4-bromo-N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(Br)cc3)C2=O)ccc1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H29BrN2O4S2/c1-5-36-25-16-20(8-15-24(25)37-18-19-6-11-22(12-7-19)30(2,3)4)17-26-28(35)33(29(38)39-26)32-27(34)21-9-13-23(31)14-10-21/h6-17H,5,18H2,1-4H3,(H,32,34)/b26-17+ |
| InChIKey | ARQAQPCTOBLUBO-YZSQISJMSA-N |
| XLogP | 7.27 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.61 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|