C28H26N2O3S2 — CID 19200101
N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19200101) has the molecular formula C28H26N2O3S2 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19200101 |
| Molecular Formula | C28H26N2O3S2 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | N-[(5E)-5-[[4-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CC(C)(C)c1ccc(COc2ccc(/C=C3/SC(=S)N(NC(=O)c4ccccc4)C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H26N2O3S2/c1-28(2,3)22-13-9-20(10-14-22)18-33-23-15-11-19(12-16-23)17-24-26(32)30(27(34)35-24)29-25(31)21-7-5-4-6-8-21/h4-17H,18H2,1-3H3,(H,29,31)/b24-17+ |
| InChIKey | MIGBFFXGUXEJIV-JJIBRWJFSA-N |
| XLogP | 6.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|