C25H20N2O3S2 — CID 19176651
2-methyl-N-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19176651) has the molecular formula C25H20N2O3S2 and a molecular weight of 460.58 g/mol. Its IUPAC name is 2-methyl-N-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-methyl-N-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19176651 |
| Molecular Formula | C25H20N2O3S2 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | 2-methyl-N-[(5Z)-4-oxo-5-[(4-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccccc1C(=O)NN1C(=O)/C(=C/c2ccc(OCc3ccccc3)cc2)SC1=S |
| InChI | InChI=1S/C25H20N2O3S2/c1-17-7-5-6-10-21(17)23(28)26-27-24(29)22(32-25(27)31)15-18-11-13-20(14-12-18)30-16-19-8-3-2-4-9-19/h2-15H,16H2,1H3,(H,26,28)/b22-15- |
| InChIKey | WOWVXSIRYIUORM-JCMHNJIXSA-N |
| XLogP | 5.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|