C25H27NO5S2 — CID 19198508
3-[(5E)-5-[[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 19198508) has the molecular formula C25H27NO5S2 and a molecular weight of 485.63 g/mol. Its IUPAC name is 3-[(5E)-5-[[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5E)-5-[[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 19198508 |
| Molecular Formula | C25H27NO5S2 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.13 |
| IUPAC Name | 3-[(5E)-5-[[3-ethoxy-4-[(2,4,5-trimethylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(CCC(=O)O)C2=O)ccc1OCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C25H27NO5S2/c1-5-30-21-12-18(13-22-24(29)26(25(32)33-22)9-8-23(27)28)6-7-20(21)31-14-19-11-16(3)15(2)10-17(19)4/h6-7,10-13H,5,8-9,14H2,1-4H3,(H,27,28)/b22-13+ |
| InChIKey | PUQKLXNOFXFFNT-LPYMAVHISA-N |
| XLogP | 5.27 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|