C18H19NO7S2 — CID 50873273
2-[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 50873273) has the molecular formula C18H19NO7S2 and a molecular weight of 425.48 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 50873273 |
| Molecular Formula | C18H19NO7S2 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.06 |
| IUPAC Name | 2-[(5E)-5-[[3-ethoxy-4-(2-ethoxy-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOC(=O)COc1ccc(/C=C2/SC(=S)N(CC(=O)O)C2=O)cc1OCC |
| InChI | InChI=1S/C18H19NO7S2/c1-3-24-13-7-11(5-6-12(13)26-10-16(22)25-4-2)8-14-17(23)19(9-15(20)21)18(27)28-14/h5-8H,3-4,9-10H2,1-2H3,(H,20,21)/b14-8+ |
| InChIKey | YKGQTJVRHBETFM-RIYZIHGNSA-N |
| XLogP | 2.31 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|