C26H36N2O6S2 — CID 19196178
ethyl 6-[(5E)-5-[[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 19196178) has the molecular formula C26H36N2O6S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is ethyl 6-[(5E)-5-[[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | ethyl 6-[(5E)-5-[[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 19196178 |
| Molecular Formula | C26H36N2O6S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | ethyl 6-[(5E)-5-[[4-[2-(diethylamino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCOC(=O)CCCCCN1C(=O)/C(=C\c2ccc(OCC(=O)N(CC)CC)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C26H36N2O6S2/c1-5-27(6-2)23(29)18-34-20-14-13-19(16-21(20)32-7-3)17-22-25(31)28(26(35)36-22)15-11-9-10-12-24(30)33-8-4/h13-14,16-17H,5-12,15,18H2,1-4H3/b22-17+ |
| InChIKey | IQRJYOFLBFKQJF-OQKWZONESA-N |
| XLogP | 4.66 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|