C23H28N2O7S2 — CID 19199331
ethyl 4-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199331) has the molecular formula C23H28N2O7S2 and a molecular weight of 508.62 g/mol. Its IUPAC name is ethyl 4-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199331 |
| Molecular Formula | C23H28N2O7S2 |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.13 |
| IUPAC Name | ethyl 4-[(5E)-5-[[3-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C\c2ccc(OCC(=O)N3CCOCC3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C23H28N2O7S2/c1-3-31-21(27)5-4-8-25-22(28)19(34-23(25)33)14-16-6-7-17(18(13-16)29-2)32-15-20(26)24-9-11-30-12-10-24/h6-7,13-14H,3-5,8-12,15H2,1-2H3/b19-14+ |
| InChIKey | XQKBRGKNXNKZQS-XMHGGMMESA-N |
| XLogP | 2.48 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|