C23H27BrN2O7S2 — CID 19199354
ethyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199354) has the molecular formula C23H27BrN2O7S2 and a molecular weight of 587.51 g/mol. Its IUPAC name is ethyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | ethyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199354 |
| Molecular Formula | C23H27BrN2O7S2 |
| Molecular Weight | 587.51 g/mol |
| Exact Mass | 586.04 |
| IUPAC Name | ethyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)/C(=C\c2cc(Br)c(OCC(=O)N3CCOCC3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C23H27BrN2O7S2/c1-3-32-20(28)5-4-6-26-22(29)18(35-23(26)34)13-15-11-16(24)21(17(12-15)30-2)33-14-19(27)25-7-9-31-10-8-25/h11-13H,3-10,14H2,1-2H3/b18-13+ |
| InChIKey | MYOXWNHYSOERMI-QGOAFFKASA-N |
| XLogP | 3.24 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.51 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|