C25H31BrN2O6S2 — CID 19199552
propyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199552) has the molecular formula C25H31BrN2O6S2 and a molecular weight of 599.57 g/mol. Its IUPAC name is propyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199552 |
| Molecular Formula | C25H31BrN2O6S2 |
| Molecular Weight | 599.57 g/mol |
| Exact Mass | 598.08 |
| IUPAC Name | propyl 4-[(5E)-5-[[3-bromo-5-methoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C\c2cc(Br)c(OCC(=O)N3CCCCC3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C25H31BrN2O6S2/c1-3-12-33-22(30)8-7-11-28-24(31)20(36-25(28)35)15-17-13-18(26)23(19(14-17)32-2)34-16-21(29)27-9-5-4-6-10-27/h13-15H,3-12,16H2,1-2H3/b20-15+ |
| InChIKey | CUROMONHLVSZIO-HMMYKYKNSA-N |
| XLogP | 4.78 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|