C25H24BrCl2NO5S2 — CID 19199538
propyl 4-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199538) has the molecular formula C25H24BrCl2NO5S2 and a molecular weight of 633.41 g/mol. Its IUPAC name is propyl 4-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199538 |
| Molecular Formula | C25H24BrCl2NO5S2 |
| Molecular Weight | 633.41 g/mol |
| Exact Mass | 630.97 |
| IUPAC Name | propyl 4-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)SC1=S |
| InChI | InChI=1S/C25H24BrCl2NO5S2/c1-3-9-33-22(30)5-4-8-29-24(31)21(36-25(29)35)12-15-10-18(26)23(20(11-15)32-2)34-14-16-6-7-17(27)13-19(16)28/h6-7,10-13H,3-5,8-9,14H2,1-2H3/b21-12- |
| InChIKey | RIGQYGFRNYNOSA-MTJSOVHGSA-N |
| XLogP | 7.28 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.41 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|