C23H21BrClNO5S2 — CID 19199193
methyl 4-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199193) has the molecular formula C23H21BrClNO5S2 and a molecular weight of 570.91 g/mol. Its IUPAC name is methyl 4-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | methyl 4-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199193 |
| Molecular Formula | C23H21BrClNO5S2 |
| Molecular Weight | 570.91 g/mol |
| Exact Mass | 568.97 |
| IUPAC Name | methyl 4-[(5Z)-5-[[3-bromo-4-[(4-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | COC(=O)CCCN1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3)c(OC)c2)SC1=S |
| InChI | InChI=1S/C23H21BrClNO5S2/c1-29-18-11-15(10-17(24)21(18)31-13-14-5-7-16(25)8-6-14)12-19-22(28)26(23(32)33-19)9-3-4-20(27)30-2/h5-8,10-12H,3-4,9,13H2,1-2H3/b19-12- |
| InChIKey | VKJNMJGYEWIMNQ-UNOMPAQXSA-N |
| XLogP | 5.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.91 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|