C28H22BrCl2NO5S2 — CID 19198066
ethyl 2-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198066) has the molecular formula C28H22BrCl2NO5S2 and a molecular weight of 667.43 g/mol. Its IUPAC name is ethyl 2-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198066 |
| Molecular Formula | C28H22BrCl2NO5S2 |
| Molecular Weight | 667.43 g/mol |
| Exact Mass | 664.95 |
| IUPAC Name | ethyl 2-[(5Z)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1C(=O)/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)SC1=S |
| InChI | InChI=1S/C28H22BrCl2NO5S2/c1-3-36-27(34)24(17-7-5-4-6-8-17)32-26(33)23(39-28(32)38)13-16-11-20(29)25(22(12-16)35-2)37-15-18-9-10-19(30)14-21(18)31/h4-14,24H,3,15H2,1-2H3/b23-13- |
| InChIKey | VENDYLXXVYLTHT-QRVIBDJDSA-N |
| XLogP | 7.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.43 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|