C31H30BrNO5S2 — CID 19198314
propyl 2-[(5Z)-5-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198314) has the molecular formula C31H30BrNO5S2 and a molecular weight of 640.62 g/mol. Its IUPAC name is propyl 2-[(5Z)-5-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | propyl 2-[(5Z)-5-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198314 |
| Molecular Formula | C31H30BrNO5S2 |
| Molecular Weight | 640.62 g/mol |
| Exact Mass | 639.07 |
| IUPAC Name | propyl 2-[(5Z)-5-[[3-bromo-5-ethoxy-4-[(2-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCOC(=O)C(c1ccccc1)N1C(=O)/C(=C/c2cc(Br)c(OCc3ccccc3C)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C31H30BrNO5S2/c1-4-15-37-30(35)27(22-12-7-6-8-13-22)33-29(34)26(40-31(33)39)18-21-16-24(32)28(25(17-21)36-5-2)38-19-23-14-10-9-11-20(23)3/h6-14,16-18,27H,4-5,15,19H2,1-3H3/b26-18- |
| InChIKey | OZAZOIKPLPRWRL-ITYLOYPMSA-N |
| XLogP | 7.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.62 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|