C28H29BrN2O7S2 — CID 19198104
ethyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198104) has the molecular formula C28H29BrN2O7S2 and a molecular weight of 649.59 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198104 |
| Molecular Formula | C28H29BrN2O7S2 |
| Molecular Weight | 649.59 g/mol |
| Exact Mass | 648.06 |
| IUPAC Name | ethyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1C(=O)/C(=C\c2cc(Br)c(OCC(=O)N3CCOCC3)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C28H29BrN2O7S2/c1-3-36-21-15-18(14-20(29)25(21)38-17-23(32)30-10-12-35-13-11-30)16-22-26(33)31(28(39)40-22)24(27(34)37-4-2)19-8-6-5-7-9-19/h5-9,14-16,24H,3-4,10-13,17H2,1-2H3/b22-16+ |
| InChIKey | SECMQFZSPGHLBO-CJLVFECKSA-N |
| XLogP | 4.59 |
| TPSA | 94.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.59 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|