C26H26N2O7S2 — CID 19197708
2-[(5E)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid (PubChem CID 19197708) has the molecular formula C26H26N2O7S2 and a molecular weight of 542.64 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid.
| Compound Name | 2-[(5E)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19197708 |
| Molecular Formula | C26H26N2O7S2 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-[(5E)-5-[[3-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(C(C(=O)O)c3ccccc3)C2=O)ccc1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C26H26N2O7S2/c1-2-34-20-14-17(8-9-19(20)35-16-22(29)27-10-12-33-13-11-27)15-21-24(30)28(26(36)37-21)23(25(31)32)18-6-4-3-5-7-18/h3-9,14-15,23H,2,10-13,16H2,1H3,(H,31,32)/b21-15+ |
| InChIKey | TVXGULXIVSPQTL-RCCKNPSSSA-N |
| XLogP | 3.35 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|