C24H23BrN2O5S2 — CID 126250596
(5Z)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 126250596) has the molecular formula C24H23BrN2O5S2 and a molecular weight of 563.50 g/mol. Its IUPAC name is (5Z)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 126250596 |
| Molecular Formula | C24H23BrN2O5S2 |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 562.02 |
| IUPAC Name | (5Z)-5-[[3-bromo-5-ethoxy-4-(2-morpholin-4-yl-2-oxoethoxy)phenyl]methylidene]-3-phenyl-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3ccccc3)C2=O)cc(Br)c1OCC(=O)N1CCOCC1 |
| InChI | InChI=1S/C24H23BrN2O5S2/c1-2-31-19-13-16(12-18(25)22(19)32-15-21(28)26-8-10-30-11-9-26)14-20-23(29)27(24(33)34-20)17-6-4-3-5-7-17/h3-7,12-14H,2,8-11,15H2,1H3/b20-14- |
| InChIKey | CHYQOTISIKZMPK-ZHZULCJRSA-N |
| XLogP | 4.49 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|