C26H25BrClN3O5S2 — CID 19200223
N-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chlorobenzamide (PubChem CID 19200223) has the molecular formula C26H25BrClN3O5S2 and a molecular weight of 638.99 g/mol. Its IUPAC name is N-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chlorobenzamide.
| Compound Name | N-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chlorobenzamide |
|---|---|
| PubChem CID | 19200223 |
| Molecular Formula | C26H25BrClN3O5S2 |
| Molecular Weight | 638.99 g/mol |
| Exact Mass | 637.01 |
| IUPAC Name | N-[(5E)-5-[[3-bromo-5-ethoxy-4-(2-oxo-2-piperidin-1-ylethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-chlorobenzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3ccccc3Cl)C2=O)cc(Br)c1OCC(=O)N1CCCCC1 |
| InChI | InChI=1S/C26H25BrClN3O5S2/c1-2-35-20-13-16(12-18(27)23(20)36-15-22(32)30-10-6-3-7-11-30)14-21-25(34)31(26(37)38-21)29-24(33)17-8-4-5-9-19(17)28/h4-5,8-9,12-14H,2-3,6-7,10-11,15H2,1H3,(H,29,33)/b21-14+ |
| InChIKey | IMCWPRFLVHQBOC-KGENOOAVSA-N |
| XLogP | 5.44 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.99 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|