C28H31BrN2O6S2 — CID 19198106
ethyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198106) has the molecular formula C28H31BrN2O6S2 and a molecular weight of 635.60 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198106 |
| Molecular Formula | C28H31BrN2O6S2 |
| Molecular Weight | 635.60 g/mol |
| Exact Mass | 634.08 |
| IUPAC Name | ethyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCOC(=O)C(c1ccccc1)N1C(=O)/C(=C\c2cc(Br)c(OCC(=O)N(CC)CC)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C28H31BrN2O6S2/c1-5-30(6-2)23(32)17-37-25-20(29)14-18(15-21(25)35-7-3)16-22-26(33)31(28(38)39-22)24(27(34)36-8-4)19-12-10-9-11-13-19/h9-16,24H,5-8,17H2,1-4H3/b22-16+ |
| InChIKey | RMERVRKINOZLBR-CJLVFECKSA-N |
| XLogP | 5.60 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.60 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|