C26H27BrN2O6S2 — CID 19197864
methyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19197864) has the molecular formula C26H27BrN2O6S2 and a molecular weight of 607.55 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19197864 |
| Molecular Formula | C26H27BrN2O6S2 |
| Molecular Weight | 607.55 g/mol |
| Exact Mass | 606.05 |
| IUPAC Name | methyl 2-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCN(CC)C(=O)COc1c(Br)cc(/C=C2/SC(=S)N(C(C(=O)OC)c3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C26H27BrN2O6S2/c1-5-28(6-2)21(30)15-35-23-18(27)12-16(13-19(23)33-3)14-20-24(31)29(26(36)37-20)22(25(32)34-4)17-10-8-7-9-11-17/h7-14,22H,5-6,15H2,1-4H3/b20-14+ |
| InChIKey | HWVHOGNEIBLLCK-XSFVSMFZSA-N |
| XLogP | 4.82 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|