C26H28BrNO5S2 — CID 19197883
methyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(3-methylbutoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19197883) has the molecular formula C26H28BrNO5S2 and a molecular weight of 578.55 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(3-methylbutoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(3-methylbutoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19197883 |
| Molecular Formula | C26H28BrNO5S2 |
| Molecular Weight | 578.55 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | methyl 2-[(5E)-5-[[3-bromo-5-ethoxy-4-(3-methylbutoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(C(C(=O)OC)c3ccccc3)C2=O)cc(Br)c1OCCC(C)C |
| InChI | InChI=1S/C26H28BrNO5S2/c1-5-32-20-14-17(13-19(27)23(20)33-12-11-16(2)3)15-21-24(29)28(26(34)35-21)22(25(30)31-4)18-9-7-6-8-10-18/h6-10,13-16,22H,5,11-12H2,1-4H3/b21-15+ |
| InChIKey | CEQBNWMAJQXWSA-RCCKNPSSSA-N |
| XLogP | 6.39 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.55 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|