C28H23Br2NO5S2 — CID 19197881
methyl 2-[(5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19197881) has the molecular formula C28H23Br2NO5S2 and a molecular weight of 677.44 g/mol. Its IUPAC name is methyl 2-[(5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | methyl 2-[(5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19197881 |
| Molecular Formula | C28H23Br2NO5S2 |
| Molecular Weight | 677.44 g/mol |
| Exact Mass | 674.94 |
| IUPAC Name | methyl 2-[(5E)-5-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(C(C(=O)OC)c3ccccc3)C2=O)cc(Br)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H23Br2NO5S2/c1-3-35-22-14-18(13-21(30)25(22)36-16-17-9-11-20(29)12-10-17)15-23-26(32)31(28(37)38-23)24(27(33)34-2)19-7-5-4-6-8-19/h4-15,24H,3,16H2,1-2H3/b23-15+ |
| InChIKey | HHCCUZRZKOBKMK-HZHRSRAPSA-N |
| XLogP | 7.30 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.44 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|