C24H22BrCl2NO6S — CID 126202483
butyl 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126202483) has the molecular formula C24H22BrCl2NO6S and a molecular weight of 603.32 g/mol. Its IUPAC name is butyl 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126202483 |
| Molecular Formula | C24H22BrCl2NO6S |
| Molecular Weight | 603.32 g/mol |
| Exact Mass | 600.97 |
| IUPAC Name | butyl 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)C1=O |
| InChI | InChI=1S/C24H22BrCl2NO6S/c1-3-4-7-33-21(29)12-28-23(30)20(35-24(28)31)10-14-8-17(25)22(19(9-14)32-2)34-13-15-5-6-16(26)11-18(15)27/h5-6,8-11H,3-4,7,12-13H2,1-2H3/b20-10+ |
| InChIKey | UXSQGKNQUMVTJU-KEBDBYFISA-N |
| XLogP | 6.72 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.32 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|