C21H16BrCl2NO4S — CID 126074509
(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione (PubChem CID 126074509) has the molecular formula C21H16BrCl2NO4S and a molecular weight of 529.24 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 126074509 |
| Molecular Formula | C21H16BrCl2NO4S |
| Molecular Weight | 529.24 g/mol |
| Exact Mass | 526.94 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-prop-2-enyl-1,3-thiazolidine-2,4-dione |
| SMILES | C=CCN1C(=O)S/C(=C/c2cc(Br)c(OCc3ccc(Cl)cc3Cl)c(OC)c2)C1=O |
| InChI | InChI=1S/C21H16BrCl2NO4S/c1-3-6-25-20(26)18(30-21(25)27)9-12-7-15(22)19(17(8-12)28-2)29-11-13-4-5-14(23)10-16(13)24/h3-5,7-10H,1,6,11H2,2H3/b18-9+ |
| InChIKey | HKZDBDIZXRUCDE-GIJQJNRQSA-N |
| XLogP | 6.57 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.24 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|