C27H21BrCl2N2O5S — CID 126162202
2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide (PubChem CID 126162202) has the molecular formula C27H21BrCl2N2O5S and a molecular weight of 636.35 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126162202 |
| Molecular Formula | C27H21BrCl2N2O5S |
| Molecular Weight | 636.35 g/mol |
| Exact Mass | 633.97 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-methylphenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccccc3C)C2=O)cc(Br)c1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H21BrCl2N2O5S/c1-15-5-3-4-6-21(15)31-24(33)13-32-26(34)23(38-27(32)35)11-16-9-19(28)25(22(10-16)36-2)37-14-17-7-8-18(29)12-20(17)30/h3-12H,13-14H2,1-2H3,(H,31,33)/b23-11+ |
| InChIKey | RYKARCXSIHRBAR-FOKLQQMPSA-N |
| XLogP | 7.33 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.35 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|