C25H16Br2Cl2N2O4S — CID 126335406
2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide (PubChem CID 126335406) has the molecular formula C25H16Br2Cl2N2O4S and a molecular weight of 671.19 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
|---|---|
| PubChem CID | 126335406 |
| Molecular Formula | C25H16Br2Cl2N2O4S |
| Molecular Weight | 671.19 g/mol |
| Exact Mass | 667.86 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2-bromophenyl)acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C/c2ccc(OCc3ccc(Cl)cc3Cl)c(Br)c2)C1=O)Nc1ccccc1Br |
| InChI | InChI=1S/C25H16Br2Cl2N2O4S/c26-17-3-1-2-4-20(17)30-23(32)12-31-24(33)22(36-25(31)34)10-14-5-8-21(18(27)9-14)35-13-15-6-7-16(28)11-19(15)29/h1-11H,12-13H2,(H,30,32)/b22-10+ |
| InChIKey | CZQZWYBHTOPWTM-LSHDLFTRSA-N |
| XLogP | 7.77 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.19 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|