C26H17BrClF3N2O5S — CID 126265516
2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 126265516) has the molecular formula C26H17BrClF3N2O5S and a molecular weight of 641.85 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 126265516 |
| Molecular Formula | C26H17BrClF3N2O5S |
| Molecular Weight | 641.85 g/mol |
| Exact Mass | 639.97 |
| IUPAC Name | 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | COc1cc(/C=C2/SC(=O)N(CC(=O)Nc3ccc(F)c(F)c3F)C2=O)cc(Br)c1OCc1ccccc1Cl |
| InChI | InChI=1S/C26H17BrClF3N2O5S/c1-37-19-9-13(8-15(27)24(19)38-12-14-4-2-3-5-16(14)28)10-20-25(35)33(26(36)39-20)11-21(34)32-18-7-6-17(29)22(30)23(18)31/h2-10H,11-12H2,1H3,(H,32,34)/b20-10+ |
| InChIKey | YVZTWENWFOYWFX-KEBDBYFISA-N |
| XLogP | 6.78 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.85 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|