C25H25BrClNO6S — CID 126206620
butyl 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate (PubChem CID 126206620) has the molecular formula C25H25BrClNO6S and a molecular weight of 582.90 g/mol. Its IUPAC name is butyl 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate.
| Compound Name | butyl 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 126206620 |
| Molecular Formula | C25H25BrClNO6S |
| Molecular Weight | 582.90 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | butyl 2-[(5E)-5-[[3-bromo-4-[(2-chlorophenyl)methoxy]-5-ethoxyphenyl]methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCCOC(=O)CN1C(=O)S/C(=C/c2cc(Br)c(OCc3ccccc3Cl)c(OCC)c2)C1=O |
| InChI | InChI=1S/C25H25BrClNO6S/c1-3-5-10-33-22(29)14-28-24(30)21(35-25(28)31)13-16-11-18(26)23(20(12-16)32-4-2)34-15-17-8-6-7-9-19(17)27/h6-9,11-13H,3-5,10,14-15H2,1-2H3/b21-13+ |
| InChIKey | RTFJUSYCJRPIFE-FYJGNVAPSA-N |
| XLogP | 6.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.90 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|