C21H25BrN2O6S2 — CID 19199068
4-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid (PubChem CID 19199068) has the molecular formula C21H25BrN2O6S2 and a molecular weight of 545.48 g/mol. Its IUPAC name is 4-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid.
| Compound Name | 4-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
|---|---|
| PubChem CID | 19199068 |
| Molecular Formula | C21H25BrN2O6S2 |
| Molecular Weight | 545.48 g/mol |
| Exact Mass | 544.03 |
| IUPAC Name | 4-[(5E)-5-[[3-bromo-4-[2-(diethylamino)-2-oxoethoxy]-5-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoic acid |
| SMILES | CCN(CC)C(=O)COc1c(Br)cc(/C=C2/SC(=S)N(CCCC(=O)O)C2=O)cc1OC |
| InChI | InChI=1S/C21H25BrN2O6S2/c1-4-23(5-2)17(25)12-30-19-14(22)9-13(10-15(19)29-3)11-16-20(28)24(21(31)32-16)8-6-7-18(26)27/h9-11H,4-8,12H2,1-3H3,(H,26,27)/b16-11+ |
| InChIKey | REYMSCRLSLMIFN-LFIBNONCSA-N |
| XLogP | 3.77 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.48 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|