C22H28BrNO5S2 — CID 19195760
6-[(5Z)-5-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid (PubChem CID 19195760) has the molecular formula C22H28BrNO5S2 and a molecular weight of 530.51 g/mol. Its IUPAC name is 6-[(5Z)-5-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid.
| Compound Name | 6-[(5Z)-5-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 19195760 |
| Molecular Formula | C22H28BrNO5S2 |
| Molecular Weight | 530.51 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | 6-[(5Z)-5-[(3-bromo-4-butoxy-5-ethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoic acid |
| SMILES | CCCCOc1c(Br)cc(/C=C2\SC(=S)N(CCCCCC(=O)O)C2=O)cc1OCC |
| InChI | InChI=1S/C22H28BrNO5S2/c1-3-5-11-29-20-16(23)12-15(13-17(20)28-4-2)14-18-21(27)24(22(30)31-18)10-8-6-7-9-19(25)26/h12-14H,3-11H2,1-2H3,(H,25,26)/b18-14- |
| InChIKey | POFFGECNFHFTNL-JXAWBTAJSA-N |
| XLogP | 5.87 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.51 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|