C16H16BrNO5S2 — CID 6312899
2-[(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 6312899) has the molecular formula C16H16BrNO5S2 and a molecular weight of 446.34 g/mol. Its IUPAC name is 2-[(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 6312899 |
| Molecular Formula | C16H16BrNO5S2 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | 2-[(5Z)-5-[(3-bromo-4,5-diethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(CC(=O)O)C2=O)cc(Br)c1OCC |
| InChI | InChI=1S/C16H16BrNO5S2/c1-3-22-11-6-9(5-10(17)14(11)23-4-2)7-12-15(21)18(8-13(19)20)16(24)25-12/h5-7H,3-4,8H2,1-2H3,(H,19,20)/b12-7- |
| InChIKey | YSJLFROAEYMCJB-GHXNOFRVSA-N |
| XLogP | 3.53 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|