C19H15BrCl2N2O4 — CID 126198747
(5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methylimidazolidine-2,4-dione (PubChem CID 126198747) has the molecular formula C19H15BrCl2N2O4 and a molecular weight of 486.15 g/mol. Its IUPAC name is (5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methylimidazolidine-2,4-dione.
| Compound Name | (5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126198747 |
| Molecular Formula | C19H15BrCl2N2O4 |
| Molecular Weight | 486.15 g/mol |
| Exact Mass | 483.96 |
| IUPAC Name | (5E)-5-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-3-methylimidazolidine-2,4-dione |
| SMILES | COc1cc(/C=C2/NC(=O)N(C)C2=O)cc(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H15BrCl2N2O4/c1-24-18(25)15(23-19(24)26)7-11-5-12(20)17(16(8-11)27-2)28-9-10-3-4-13(21)14(22)6-10/h3-8H,9H2,1-2H3,(H,23,26)/b15-7+ |
| InChIKey | DQSPCGJHCXSHMK-VIZOYTHASA-N |
| XLogP | 4.87 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.15 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|