C26H22BrCl2NO3 — CID 126125832
(3Z)-3-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-propylindol-2-one (PubChem CID 126125832) has the molecular formula C26H22BrCl2NO3 and a molecular weight of 547.28 g/mol. Its IUPAC name is (3Z)-3-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-propylindol-2-one.
| Compound Name | (3Z)-3-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-propylindol-2-one |
|---|---|
| PubChem CID | 126125832 |
| Molecular Formula | C26H22BrCl2NO3 |
| Molecular Weight | 547.28 g/mol |
| Exact Mass | 545.02 |
| IUPAC Name | (3Z)-3-[[3-bromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-propylindol-2-one |
| SMILES | CCCN1C(=O)/C(=C\c2cc(Br)c(OCc3ccc(Cl)c(Cl)c3)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C26H22BrCl2NO3/c1-3-10-30-23-7-5-4-6-18(23)19(26(30)31)11-17-12-20(27)25(24(14-17)32-2)33-15-16-8-9-21(28)22(29)13-16/h4-9,11-14H,3,10,15H2,1-2H3/b19-11- |
| InChIKey | PMILZGRCTVXTEZ-ODLFYWEKSA-N |
| XLogP | 7.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.28 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|