C25H21BrFNO3 — CID 126118552
(3Z)-3-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-ethylindol-2-one (PubChem CID 126118552) has the molecular formula C25H21BrFNO3 and a molecular weight of 482.35 g/mol. Its IUPAC name is (3Z)-3-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126118552 |
| Molecular Formula | C25H21BrFNO3 |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 481.07 |
| IUPAC Name | (3Z)-3-[[3-bromo-4-[(3-fluorophenyl)methoxy]-5-methoxyphenyl]methylidene]-1-ethylindol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2cc(Br)c(OCc3cccc(F)c3)c(OC)c2)c2ccccc21 |
| InChI | InChI=1S/C25H21BrFNO3/c1-3-28-22-10-5-4-9-19(22)20(25(28)29)12-17-13-21(26)24(23(14-17)30-2)31-15-16-7-6-8-18(27)11-16/h4-14H,3,15H2,1-2H3/b20-12- |
| InChIKey | FLRRIXYMJRAJCG-NDENLUEZSA-N |
| XLogP | 6.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|