C26H23BrINO3 — CID 126128152
(3Z)-3-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1-ethylindol-2-one (PubChem CID 126128152) has the molecular formula C26H23BrINO3 and a molecular weight of 604.28 g/mol. Its IUPAC name is (3Z)-3-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1-ethylindol-2-one.
| Compound Name | (3Z)-3-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1-ethylindol-2-one |
|---|---|
| PubChem CID | 126128152 |
| Molecular Formula | C26H23BrINO3 |
| Molecular Weight | 604.28 g/mol |
| Exact Mass | 602.99 |
| IUPAC Name | (3Z)-3-[[4-[(4-bromophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylidene]-1-ethylindol-2-one |
| SMILES | CCOc1cc(/C=C2\C(=O)N(CC)c3ccccc32)cc(I)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C26H23BrINO3/c1-3-29-23-8-6-5-7-20(23)21(26(29)30)13-18-14-22(28)25(24(15-18)31-4-2)32-16-17-9-11-19(27)12-10-17/h5-15H,3-4,16H2,1-2H3/b21-13- |
| InChIKey | WYYGPPXMXNIMGL-BKUYFWCQSA-N |
| XLogP | 6.94 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.28 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|