C21H20INO3 — CID 126118077
(3Z)-1-ethyl-3-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]indol-2-one (PubChem CID 126118077) has the molecular formula C21H20INO3 and a molecular weight of 461.30 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]indol-2-one.
| Compound Name | (3Z)-1-ethyl-3-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]indol-2-one |
|---|---|
| PubChem CID | 126118077 |
| Molecular Formula | C21H20INO3 |
| Molecular Weight | 461.30 g/mol |
| Exact Mass | 461.05 |
| IUPAC Name | (3Z)-1-ethyl-3-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]indol-2-one |
| SMILES | C=CCOc1c(I)cc(/C=C2\C(=O)N(CC)c3ccccc32)cc1OC |
| InChI | InChI=1S/C21H20INO3/c1-4-10-26-20-17(22)12-14(13-19(20)25-3)11-16-15-8-6-7-9-18(15)23(5-2)21(16)24/h4,6-9,11-13H,1,5,10H2,2-3H3/b16-11- |
| InChIKey | COUCFPHPYPUGLO-WJDWOHSUSA-N |
| XLogP | 4.77 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.30 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|