C21H19IN2O4 — CID 126252247
(5Z)-3-benzyl-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 126252247) has the molecular formula C21H19IN2O4 and a molecular weight of 490.30 g/mol. Its IUPAC name is (5Z)-3-benzyl-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-benzyl-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 126252247 |
| Molecular Formula | C21H19IN2O4 |
| Molecular Weight | 490.30 g/mol |
| Exact Mass | 490.04 |
| IUPAC Name | (5Z)-3-benzyl-5-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | C=CCOc1c(I)cc(/C=C2\NC(=O)N(Cc3ccccc3)C2=O)cc1OC |
| InChI | InChI=1S/C21H19IN2O4/c1-3-9-28-19-16(22)10-15(12-18(19)27-2)11-17-20(25)24(21(26)23-17)13-14-7-5-4-6-8-14/h3-8,10-12H,1,9,13H2,2H3,(H,23,26)/b17-11- |
| InChIKey | DKZVDWBCDMQKMM-BOPFTXTBSA-N |
| XLogP | 3.96 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|