C17H17IN2O6 — CID 4526310
methyl 2-[4-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 4526310) has the molecular formula C17H17IN2O6 and a molecular weight of 472.24 g/mol. Its IUPAC name is methyl 2-[4-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[4-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 4526310 |
| Molecular Formula | C17H17IN2O6 |
| Molecular Weight | 472.24 g/mol |
| Exact Mass | 472.01 |
| IUPAC Name | methyl 2-[4-[(3-iodo-5-methoxy-4-prop-2-enoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | C=CCOc1c(I)cc(C=C2NC(=O)N(CC(=O)OC)C2=O)cc1OC |
| InChI | InChI=1S/C17H17IN2O6/c1-4-5-26-15-11(18)6-10(8-13(15)24-2)7-12-16(22)20(17(23)19-12)9-14(21)25-3/h4,6-8H,1,5,9H2,2-3H3,(H,19,23) |
| InChIKey | IGKLTCURQPRUDN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|