C21H18FIN2O6 — CID 126077167
methyl 2-[4-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126077167) has the molecular formula C21H18FIN2O6 and a molecular weight of 540.29 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126077167 |
| Molecular Formula | C21H18FIN2O6 |
| Molecular Weight | 540.29 g/mol |
| Exact Mass | 540.02 |
| IUPAC Name | methyl 2-[4-[(E)-[1-[(2-fluorophenyl)methyl]-2,5-dioxoimidazolidin-4-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2/NC(=O)N(Cc3ccccc3F)C2=O)cc1OC |
| InChI | InChI=1S/C21H18FIN2O6/c1-29-17-9-12(7-15(23)19(17)31-11-18(26)30-2)8-16-20(27)25(21(28)24-16)10-13-5-3-4-6-14(13)22/h3-9H,10-11H2,1-2H3,(H,24,28)/b16-8+ |
| InChIKey | MBLKMVJBRIFIBP-LZYBPNLTSA-N |
| XLogP | 3.08 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.29 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|