C16H17IN2O6 — CID 126237843
methyl 2-[4-[(E)-(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126237843) has the molecular formula C16H17IN2O6 and a molecular weight of 460.22 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126237843 |
| Molecular Formula | C16H17IN2O6 |
| Molecular Weight | 460.22 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | methyl 2-[4-[(E)-(1-ethyl-2,5-dioxoimidazolidin-4-ylidene)methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | CCN1C(=O)N/C(=C/c2cc(I)c(OCC(=O)OC)c(OC)c2)C1=O |
| InChI | InChI=1S/C16H17IN2O6/c1-4-19-15(21)11(18-16(19)22)6-9-5-10(17)14(12(7-9)23-2)25-8-13(20)24-3/h5-7H,4,8H2,1-3H3,(H,18,22)/b11-6+ |
| InChIKey | DTQWODIAXPITSJ-IZZDOVSWSA-N |
| XLogP | 1.76 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|