C14H13ClN2O5 — CID 6490231
methyl 2-[(4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 6490231) has the molecular formula C14H13ClN2O5 and a molecular weight of 324.72 g/mol. Its IUPAC name is methyl 2-[(4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | methyl 2-[(4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 6490231 |
| Molecular Formula | C14H13ClN2O5 |
| Molecular Weight | 324.72 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | methyl 2-[(4E)-4-[(3-chloro-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)N/C(=C/c2ccc(OC)c(Cl)c2)C1=O |
| InChI | InChI=1S/C14H13ClN2O5/c1-21-11-4-3-8(5-9(11)15)6-10-13(19)17(14(20)16-10)7-12(18)22-2/h3-6H,7H2,1-2H3,(H,16,20)/b10-6+ |
| InChIKey | NUMQBRXGGKTFEV-UXBLZVDNSA-N |
| XLogP | 1.41 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.72 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|