C14H14N2O6 — CID 6491916
2-[(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid (PubChem CID 6491916) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is 2-[(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid.
| Compound Name | 2-[(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 6491916 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | 2-[(4E)-4-[(3,4-dimethoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetic acid |
| SMILES | COc1ccc(/C=C2/NC(=O)N(CC(=O)O)C2=O)cc1OC |
| InChI | InChI=1S/C14H14N2O6/c1-21-10-4-3-8(6-11(10)22-2)5-9-13(19)16(7-12(17)18)14(20)15-9/h3-6H,7H2,1-2H3,(H,15,20)(H,17,18)/b9-5+ |
| InChIKey | DNDBZXWZXBPHSC-WEVVVXLNSA-N |
| XLogP | 0.68 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|