C15H17ClN2O4 — CID 118050374
(5E)-3-(3-chloropropyl)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 118050374) has the molecular formula C15H17ClN2O4 and a molecular weight of 324.76 g/mol. Its IUPAC name is (5E)-3-(3-chloropropyl)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5E)-3-(3-chloropropyl)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 118050374 |
| Molecular Formula | C15H17ClN2O4 |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (5E)-3-(3-chloropropyl)-5-[(3,4-dimethoxyphenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | COc1ccc(/C=C2/NC(=O)N(CCCCl)C2=O)cc1OC |
| InChI | InChI=1S/C15H17ClN2O4/c1-21-12-5-4-10(9-13(12)22-2)8-11-14(19)18(7-3-6-16)15(20)17-11/h4-5,8-9H,3,6-7H2,1-2H3,(H,17,20)/b11-8+ |
| InChIKey | KFQHBCMXZPFGSL-DHZHZOJOSA-N |
| XLogP | 2.23 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|