C13H11N2O6- — CID 7457894
2-[(4E)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate (PubChem CID 7457894) has the molecular formula C13H11N2O6- and a molecular weight of 291.24 g/mol. Its IUPAC name is 2-[(4E)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate.
| Compound Name | 2-[(4E)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7457894 |
| Molecular Formula | C13H11N2O6- |
| Molecular Weight | 291.24 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[(4E)-4-[(3-hydroxy-4-methoxyphenyl)methylidene]-2,5-dioxoimidazolidin-1-yl]acetate |
| SMILES | COc1ccc(/C=C2/NC(=O)N(CC(=O)[O-])C2=O)cc1O |
| InChI | InChI=1S/C13H12N2O6/c1-21-10-3-2-7(5-9(10)16)4-8-12(19)15(6-11(17)18)13(20)14-8/h2-5,16H,6H2,1H3,(H,14,20)(H,17,18)/p-1/b8-4+ |
| InChIKey | UIZVHHKXPYSLKM-XBXARRHUSA-M |
| XLogP | -0.96 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.24 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|