C13H8N2O6-2 — CID 7457869
4-[(E)-[1-(carboxylatomethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]benzoate (PubChem CID 7457869) has the molecular formula C13H8N2O6-2 and a molecular weight of 288.22 g/mol. Its IUPAC name is 4-[(E)-[1-(carboxylatomethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]benzoate.
| Compound Name | 4-[(E)-[1-(carboxylatomethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 7457869 |
| Molecular Formula | C13H8N2O6-2 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 4-[(E)-[1-(carboxylatomethyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]benzoate |
| SMILES | O=C([O-])CN1C(=O)N/C(=C/c2ccc(C(=O)[O-])cc2)C1=O |
| InChI | InChI=1S/C13H10N2O6/c16-10(17)6-15-11(18)9(14-13(15)21)5-7-1-3-8(4-2-7)12(19)20/h1-5H,6H2,(H,14,21)(H,16,17)(H,19,20)/p-2/b9-5+ |
| InChIKey | FNPKODDASDGACN-WEVVVXLNSA-L |
| XLogP | -2.31 |
| TPSA | 129.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|