C15H11N2O5- — CID 7457874
2-[(4E)-2,5-dioxo-4-[(4-prop-2-ynoxyphenyl)methylidene]imidazolidin-1-yl]acetate (PubChem CID 7457874) has the molecular formula C15H11N2O5- and a molecular weight of 299.26 g/mol. Its IUPAC name is 2-[(4E)-2,5-dioxo-4-[(4-prop-2-ynoxyphenyl)methylidene]imidazolidin-1-yl]acetate.
| Compound Name | 2-[(4E)-2,5-dioxo-4-[(4-prop-2-ynoxyphenyl)methylidene]imidazolidin-1-yl]acetate |
|---|---|
| PubChem CID | 7457874 |
| Molecular Formula | C15H11N2O5- |
| Molecular Weight | 299.26 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[(4E)-2,5-dioxo-4-[(4-prop-2-ynoxyphenyl)methylidene]imidazolidin-1-yl]acetate |
| SMILES | C#CCOc1ccc(/C=C2/NC(=O)N(CC(=O)[O-])C2=O)cc1 |
| InChI | InChI=1S/C15H12N2O5/c1-2-7-22-11-5-3-10(4-6-11)8-12-14(20)17(9-13(18)19)15(21)16-12/h1,3-6,8H,7,9H2,(H,16,21)(H,18,19)/p-1/b12-8+ |
| InChIKey | UXKQCXHYKHXKMC-XYOKQWHBSA-M |
| XLogP | -0.66 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.26 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|