C18H13N2O5- — CID 7269294
2-[4-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]acetate (PubChem CID 7269294) has the molecular formula C18H13N2O5- and a molecular weight of 337.31 g/mol. Its IUPAC name is 2-[4-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]acetate.
| Compound Name | 2-[4-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 7269294 |
| Molecular Formula | C18H13N2O5- |
| Molecular Weight | 337.31 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 2-[4-[(E)-(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]acetate |
| SMILES | O=C([O-])COc1ccc(/C=C2/NC(=O)N(c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C18H14N2O5/c21-16(22)11-25-14-8-6-12(7-9-14)10-15-17(23)20(18(24)19-15)13-4-2-1-3-5-13/h1-10H,11H2,(H,19,24)(H,21,22)/p-1/b15-10+ |
| InChIKey | CDHUYSZIGKPOEQ-XNTDXEJSSA-M |
| XLogP | 0.91 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|