C24H19N3O4 — CID 2925783
2-[4-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]-N-phenylacetamide (PubChem CID 2925783) has the molecular formula C24H19N3O4 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[4-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 2925783 |
| Molecular Formula | C24H19N3O4 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | 2-[4-[(2,5-dioxo-1-phenylimidazolidin-4-ylidene)methyl]phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(C=C2NC(=O)N(c3ccccc3)C2=O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C24H19N3O4/c28-22(25-18-7-3-1-4-8-18)16-31-20-13-11-17(12-14-20)15-21-23(29)27(24(30)26-21)19-9-5-2-6-10-19/h1-15H,16H2,(H,25,28)(H,26,30) |
| InChIKey | IBWFHLOHLNBXBH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|