C18H13ClN2O5 — CID 21214144
2-[4-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid (PubChem CID 21214144) has the molecular formula C18H13ClN2O5 and a molecular weight of 372.76 g/mol. Its IUPAC name is 2-[4-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 21214144 |
| Molecular Formula | C18H13ClN2O5 |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | 2-[4-[(E)-[1-(3-chlorophenyl)-2,5-dioxoimidazolidin-4-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(/C=C2/NC(=O)N(c3cccc(Cl)c3)C2=O)cc1 |
| InChI | InChI=1S/C18H13ClN2O5/c19-12-2-1-3-13(9-12)21-17(24)15(20-18(21)25)8-11-4-6-14(7-5-11)26-10-16(22)23/h1-9H,10H2,(H,20,25)(H,22,23)/b15-8+ |
| InChIKey | NIIUUZWQPUNFPP-OVCLIPMQSA-N |
| XLogP | 2.90 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|