C16H10ClFN2O2 — CID 2190076
(5Z)-3-(3-chlorophenyl)-5-[(3-fluorophenyl)methylidene]imidazolidine-2,4-dione (PubChem CID 2190076) has the molecular formula C16H10ClFN2O2 and a molecular weight of 316.72 g/mol. Its IUPAC name is (5Z)-3-(3-chlorophenyl)-5-[(3-fluorophenyl)methylidene]imidazolidine-2,4-dione.
| Compound Name | (5Z)-3-(3-chlorophenyl)-5-[(3-fluorophenyl)methylidene]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2190076 |
| Molecular Formula | C16H10ClFN2O2 |
| Molecular Weight | 316.72 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | (5Z)-3-(3-chlorophenyl)-5-[(3-fluorophenyl)methylidene]imidazolidine-2,4-dione |
| SMILES | O=C1N/C(=C\c2cccc(F)c2)C(=O)N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H10ClFN2O2/c17-11-4-2-6-13(9-11)20-15(21)14(19-16(20)22)8-10-3-1-5-12(18)7-10/h1-9H,(H,19,22)/b14-8- |
| InChIKey | RGSGEXAKIWXUGC-ZSOIEALJSA-N |
| XLogP | 3.58 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|